C13H18N6O4S2 — CID 69140999
4-aminobenzenesulfonamide;2-(4-sulfamoylphenyl)guanidine (PubChem CID 69140999) has the molecular formula C13H18N6O4S2 and a molecular weight of 386.46 g/mol. Its IUPAC name is 4-aminobenzenesulfonamide;2-(4-sulfamoylphenyl)guanidine.
| Compound Name | 4-aminobenzenesulfonamide;2-(4-sulfamoylphenyl)guanidine |
|---|---|
| PubChem CID | 69140999 |
| Molecular Formula | C13H18N6O4S2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 4-aminobenzenesulfonamide;2-(4-sulfamoylphenyl)guanidine |
| SMILES | NC(N)=Nc1ccc(S(N)(=O)=O)cc1.Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C7H10N4O2S.C6H8N2O2S/c8-7(9)11-5-1-3-6(4-2-5)14(10,12)13;7-5-1-3-6(4-2-5)11(8,9)10/h1-4H,(H4,8,9,11)(H2,10,12,13);1-4H,7H2,(H2,8,9,10) |
| InChIKey | NLYLUJNCJJAGAA-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 210.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|