C10H14N2O4S — CID 174803874
4-aminobenzenesulfonamide;2-methylprop-2-enoic acid (PubChem CID 174803874) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is 4-aminobenzenesulfonamide;2-methylprop-2-enoic acid.
| Compound Name | 4-aminobenzenesulfonamide;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 174803874 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 4-aminobenzenesulfonamide;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C6H8N2O2S.C4H6O2/c7-5-1-3-6(4-2-5)11(8,9)10;1-3(2)4(5)6/h1-4H,7H2,(H2,8,9,10);1H2,2H3,(H,5,6) |
| InChIKey | PBTCGFXAIPHSNO-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|