C16H16N2O8S2 — CID 161079188
4-acetylbenzenesulfonamide;2-oxo-2-(4-sulfamoylphenyl)acetic acid (PubChem CID 161079188) has the molecular formula C16H16N2O8S2 and a molecular weight of 428.44 g/mol. Its IUPAC name is 4-acetylbenzenesulfonamide;2-oxo-2-(4-sulfamoylphenyl)acetic acid.
| Compound Name | 4-acetylbenzenesulfonamide;2-oxo-2-(4-sulfamoylphenyl)acetic acid |
|---|---|
| PubChem CID | 161079188 |
| Molecular Formula | C16H16N2O8S2 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | 4-acetylbenzenesulfonamide;2-oxo-2-(4-sulfamoylphenyl)acetic acid |
| SMILES | CC(=O)c1ccc(S(N)(=O)=O)cc1.NS(=O)(=O)c1ccc(C(=O)C(=O)O)cc1 |
| InChI | InChI=1S/C8H7NO5S.C8H9NO3S/c9-15(13,14)6-3-1-5(2-4-6)7(10)8(11)12;1-6(10)7-2-4-8(5-3-7)13(9,11)12/h1-4H,(H,11,12)(H2,9,13,14);2-5H,1H3,(H2,9,11,12) |
| InChIKey | UFRKGAWTUYCSRN-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 191.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|