About potassium 4-sulfamoylbenzoate
potassium 4-sulfamoylbenzoate (PubChem CID 23684074) has the molecular formula C7H6KNO4S
and a molecular weight of 239.29 g/mol. Its IUPAC name is potassium 4-sulfamoylbenzoate.
Molecular Properties
| Compound Name | potassium 4-sulfamoylbenzoate |
| PubChem CID | 23684074 |
| Molecular Formula | C7H6KNO4S |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 238.97 |
| IUPAC Name | potassium 4-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1ccc(C(=O)[O-])cc1.[K+] |
| InChI | InChI=1S/C7H7NO4S.K/c8-13(11,12)6-3-1-5(2-4-6)7(9)10;/h1-4H,(H,9,10)(H2,8,11,12);/q;+1/p-1 |
| InChIKey | FPKOLKQNBSMODW-UHFFFAOYSA-M |
| XLogP | -4.30 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | -4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze potassium 4-sulfamoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 4-sulfamoylbenzoate?
The IUPAC name of potassium 4-sulfamoylbenzoate (CID 23684074) is potassium 4-sulfamoylbenzoate.
What is the SMILES notation for potassium 4-sulfamoylbenzoate?
The canonical SMILES for potassium 4-sulfamoylbenzoate is NS(=O)(=O)c1ccc(C(=O)[O-])cc1.[K+].
What is the InChIKey of potassium 4-sulfamoylbenzoate?
The InChIKey is FPKOLKQNBSMODW-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H7NO4S.K/c8-13(11,12)6-3-1-5(2-4-6)7(9)10;/h1-4H,(H,9,10)(H2,8,11,12);/q;+1/p-1.
What are the key properties of potassium 4-sulfamoylbenzoate?
potassium 4-sulfamoylbenzoate has a molecular weight of 239.29 g/mol, XLogP of -4.30, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 4-sulfamoylbenzoate is sourced from PubChem (CID 23684074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).