About dipotassium;4-sulfonatobenzoate
dipotassium;4-sulfonatobenzoate (PubChem CID 112758441) has the molecular formula C7H4K2O5S
and a molecular weight of 278.37 g/mol. Its IUPAC name is dipotassium;4-sulfonatobenzoate.
Molecular Properties
| Compound Name | dipotassium;4-sulfonatobenzoate |
| PubChem CID | 112758441 |
| Molecular Formula | C7H4K2O5S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 277.91 |
| IUPAC Name | dipotassium;4-sulfonatobenzoate |
| SMILES | O=C([O-])c1ccc(S(=O)(=O)[O-])cc1.[K+].[K+] |
| InChI | InChI=1S/C7H6O5S.2K/c8-7(9)5-1-3-6(4-2-5)13(10,11)12;;/h1-4H,(H,8,9)(H,10,11,12);;/q;2*+1/p-2 |
| InChIKey | ANSRPLLZKWADRS-UHFFFAOYSA-L |
| XLogP | -7.04 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | -7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;4-sulfonatobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;4-sulfonatobenzoate?
The IUPAC name of dipotassium;4-sulfonatobenzoate (CID 112758441) is dipotassium;4-sulfonatobenzoate.
What is the SMILES notation for dipotassium;4-sulfonatobenzoate?
The canonical SMILES for dipotassium;4-sulfonatobenzoate is O=C([O-])c1ccc(S(=O)(=O)[O-])cc1.[K+].[K+].
What is the InChIKey of dipotassium;4-sulfonatobenzoate?
The InChIKey is ANSRPLLZKWADRS-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H6O5S.2K/c8-7(9)5-1-3-6(4-2-5)13(10,11)12;;/h1-4H,(H,8,9)(H,10,11,12);;/q;2*+1/p-2.
What are the key properties of dipotassium;4-sulfonatobenzoate?
dipotassium;4-sulfonatobenzoate has a molecular weight of 278.37 g/mol, XLogP of -7.04, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;4-sulfonatobenzoate is sourced from PubChem (CID 112758441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).