C8H4F3LiO3S — CID 87648638
lithium 4-(1,2,2-trifluoroethenyl)benzenesulfonate (PubChem CID 87648638) has the molecular formula C8H4F3LiO3S and a molecular weight of 244.12 g/mol. Its IUPAC name is lithium 4-(1,2,2-trifluoroethenyl)benzenesulfonate.
| Compound Name | lithium 4-(1,2,2-trifluoroethenyl)benzenesulfonate |
|---|---|
| PubChem CID | 87648638 |
| Molecular Formula | C8H4F3LiO3S |
| Molecular Weight | 244.12 g/mol |
| Exact Mass | 244.00 |
| IUPAC Name | lithium 4-(1,2,2-trifluoroethenyl)benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(C(F)=C(F)F)cc1.[Li+] |
| InChI | InChI=1S/C8H5F3O3S.Li/c9-7(8(10)11)5-1-3-6(4-2-5)15(12,13)14;/h1-4H,(H,12,13,14);/q;+1/p-1 |
| InChIKey | COSCCOJNMRECQA-UHFFFAOYSA-M |
| XLogP | -0.87 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.12 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|