C12H8Na2O8S3 — CID 167311689
disodium;4-(4-sulfonatophenyl)sulfonylbenzenesulfonate (PubChem CID 167311689) has the molecular formula C12H8Na2O8S3 and a molecular weight of 422.37 g/mol. Its IUPAC name is disodium;4-(4-sulfonatophenyl)sulfonylbenzenesulfonate.
| Compound Name | disodium;4-(4-sulfonatophenyl)sulfonylbenzenesulfonate |
|---|---|
| PubChem CID | 167311689 |
| Molecular Formula | C12H8Na2O8S3 |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 421.92 |
| IUPAC Name | disodium;4-(4-sulfonatophenyl)sulfonylbenzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(S(=O)(=O)c2ccc(S(=O)(=O)[O-])cc2)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C12H10O8S3.2Na/c13-21(14,9-1-5-11(6-2-9)22(15,16)17)10-3-7-12(8-4-10)23(18,19)20;;/h1-8H,(H,15,16,17)(H,18,19,20);;/q;2*+1/p-2 |
| InChIKey | VSIIECFETDPYHQ-UHFFFAOYSA-L |
| XLogP | -5.66 |
| TPSA | 148.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | -5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|