C14H8O6S2-2 — CID 101250013
4-[2-(4-sulfonatophenyl)ethynyl]benzenesulfonate (PubChem CID 101250013) has the molecular formula C14H8O6S2-2 and a molecular weight of 336.35 g/mol. Its IUPAC name is 4-[2-(4-sulfonatophenyl)ethynyl]benzenesulfonate.
| Compound Name | 4-[2-(4-sulfonatophenyl)ethynyl]benzenesulfonate |
|---|---|
| PubChem CID | 101250013 |
| Molecular Formula | C14H8O6S2-2 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | 4-[2-(4-sulfonatophenyl)ethynyl]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(C#Cc2ccc(S(=O)(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C14H10O6S2/c15-21(16,17)13-7-3-11(4-8-13)1-2-12-5-9-14(10-6-12)22(18,19)20/h3-10H,(H,15,16,17)(H,18,19,20)/p-2 |
| InChIKey | ATPZOIOZWXWGNP-UHFFFAOYSA-L |
| XLogP | 0.89 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|