About amino 4-acetylbenzenesulfonate
amino 4-acetylbenzenesulfonate (PubChem CID 174903574) has the molecular formula C8H9NO4S
and a molecular weight of 215.23 g/mol. Its IUPAC name is amino 4-acetylbenzenesulfonate.
Molecular Properties
| Compound Name | amino 4-acetylbenzenesulfonate |
| PubChem CID | 174903574 |
| Molecular Formula | C8H9NO4S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | amino 4-acetylbenzenesulfonate |
| SMILES | CC(=O)c1ccc(S(=O)(=O)ON)cc1 |
| InChI | InChI=1S/C8H9NO4S/c1-6(10)7-2-4-8(5-3-7)14(11,12)13-9/h2-5H,9H2,1H3 |
| InChIKey | AOBXJSUODCHLJE-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino 4-acetylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino 4-acetylbenzenesulfonate?
The IUPAC name of amino 4-acetylbenzenesulfonate (CID 174903574) is amino 4-acetylbenzenesulfonate.
What is the SMILES notation for amino 4-acetylbenzenesulfonate?
The canonical SMILES for amino 4-acetylbenzenesulfonate is CC(=O)c1ccc(S(=O)(=O)ON)cc1.
What is the InChIKey of amino 4-acetylbenzenesulfonate?
The InChIKey is AOBXJSUODCHLJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO4S/c1-6(10)7-2-4-8(5-3-7)14(11,12)13-9/h2-5H,9H2,1H3.
What are the key properties of amino 4-acetylbenzenesulfonate?
amino 4-acetylbenzenesulfonate has a molecular weight of 215.23 g/mol, XLogP of 0.47, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for amino 4-acetylbenzenesulfonate is sourced from PubChem (CID 174903574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).