C18H22N2O7S2 — CID 159148470
4-(2,2-dimethylpropanoyl)benzenesulfonamide;4-sulfamoylbenzoic acid (PubChem CID 159148470) has the molecular formula C18H22N2O7S2 and a molecular weight of 442.52 g/mol. Its IUPAC name is 4-(2,2-dimethylpropanoyl)benzenesulfonamide;4-sulfamoylbenzoic acid.
| Compound Name | 4-(2,2-dimethylpropanoyl)benzenesulfonamide;4-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 159148470 |
| Molecular Formula | C18H22N2O7S2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 4-(2,2-dimethylpropanoyl)benzenesulfonamide;4-sulfamoylbenzoic acid |
| SMILES | CC(C)(C)C(=O)c1ccc(S(N)(=O)=O)cc1.NS(=O)(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C11H15NO3S.C7H7NO4S/c1-11(2,3)10(13)8-4-6-9(7-5-8)16(12,14)15;8-13(11,12)6-3-1-5(2-4-6)7(9)10/h4-7H,1-3H3,(H2,12,14,15);1-4H,(H,9,10)(H2,8,11,12) |
| InChIKey | KIZBUWFXOOGUEO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 174.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |