C13H13N3O5S — CID 139186564
pyridine-4-carboxamide;4-sulfamoylbenzoic acid (PubChem CID 139186564) has the molecular formula C13H13N3O5S and a molecular weight of 323.33 g/mol. Its IUPAC name is pyridine-4-carboxamide;4-sulfamoylbenzoic acid.
| Compound Name | pyridine-4-carboxamide;4-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 139186564 |
| Molecular Formula | C13H13N3O5S |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | pyridine-4-carboxamide;4-sulfamoylbenzoic acid |
| SMILES | NC(=O)c1ccncc1.NS(=O)(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C7H7NO4S.C6H6N2O/c8-13(11,12)6-3-1-5(2-4-6)7(9)10;7-6(9)5-1-3-8-4-2-5/h1-4H,(H,9,10)(H2,8,11,12);1-4H,(H2,7,9) |
| InChIKey | GXINOHSJMCSUNT-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 153.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |