About propan-2-one;pyridine-4-carboxamide
propan-2-one;pyridine-4-carboxamide (PubChem CID 174689468) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is propan-2-one;pyridine-4-carboxamide.
Molecular Properties
| Compound Name | propan-2-one;pyridine-4-carboxamide |
| PubChem CID | 174689468 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | propan-2-one;pyridine-4-carboxamide |
| SMILES | CC(C)=O.NC(=O)c1ccncc1 |
| InChI | InChI=1S/C6H6N2O.C3H6O/c7-6(9)5-1-3-8-4-2-5;1-3(2)4/h1-4H,(H2,7,9);1-2H3 |
| InChIKey | BAMMIPSXHVHVBO-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-one;pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-one;pyridine-4-carboxamide?
The IUPAC name of propan-2-one;pyridine-4-carboxamide (CID 174689468) is propan-2-one;pyridine-4-carboxamide.
What is the SMILES notation for propan-2-one;pyridine-4-carboxamide?
The canonical SMILES for propan-2-one;pyridine-4-carboxamide is CC(C)=O.NC(=O)c1ccncc1.
What is the InChIKey of propan-2-one;pyridine-4-carboxamide?
The InChIKey is BAMMIPSXHVHVBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O.C3H6O/c7-6(9)5-1-3-8-4-2-5;1-3(2)4/h1-4H,(H2,7,9);1-2H3.
What are the key properties of propan-2-one;pyridine-4-carboxamide?
propan-2-one;pyridine-4-carboxamide has a molecular weight of 180.21 g/mol, XLogP of 0.78, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-one;pyridine-4-carboxamide is sourced from PubChem (CID 174689468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).