About (E)-hex-2-enoic acid;pyridine-4-carboxamide
(E)-hex-2-enoic acid;pyridine-4-carboxamide (PubChem CID 139145861) has the molecular formula C12H16N2O3
and a molecular weight of 236.27 g/mol. Its IUPAC name is (E)-hex-2-enoic acid;pyridine-4-carboxamide.
Molecular Properties
| Compound Name | (E)-hex-2-enoic acid;pyridine-4-carboxamide |
| PubChem CID | 139145861 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (E)-hex-2-enoic acid;pyridine-4-carboxamide |
| SMILES | CCC/C=C/C(=O)O.NC(=O)c1ccncc1 |
| InChI | InChI=1S/C6H6N2O.C6H10O2/c7-6(9)5-1-3-8-4-2-5;1-2-3-4-5-6(7)8/h1-4H,(H2,7,9);4-5H,2-3H2,1H3,(H,7,8)/b;5-4+ |
| InChIKey | XIVQEJMZDWFPSP-RCKHEGBHSA-N |
| XLogP | 1.61 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-hex-2-enoic acid;pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-hex-2-enoic acid;pyridine-4-carboxamide?
The IUPAC name of (E)-hex-2-enoic acid;pyridine-4-carboxamide (CID 139145861) is (E)-hex-2-enoic acid;pyridine-4-carboxamide.
What is the SMILES notation for (E)-hex-2-enoic acid;pyridine-4-carboxamide?
The canonical SMILES for (E)-hex-2-enoic acid;pyridine-4-carboxamide is CCC/C=C/C(=O)O.NC(=O)c1ccncc1.
What is the InChIKey of (E)-hex-2-enoic acid;pyridine-4-carboxamide?
The InChIKey is XIVQEJMZDWFPSP-RCKHEGBHSA-N. The full InChI is InChI=1S/C6H6N2O.C6H10O2/c7-6(9)5-1-3-8-4-2-5;1-2-3-4-5-6(7)8/h1-4H,(H2,7,9);4-5H,2-3H2,1H3,(H,7,8)/b;5-4+.
What are the key properties of (E)-hex-2-enoic acid;pyridine-4-carboxamide?
(E)-hex-2-enoic acid;pyridine-4-carboxamide has a molecular weight of 236.27 g/mol, XLogP of 1.61, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-hex-2-enoic acid;pyridine-4-carboxamide is sourced from PubChem (CID 139145861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).