6-pyridin-4-ylhex-2-enoic acid

C11H13NO2 — CID 54082671

IUPAC6-pyridin-4-ylhex-2-enoic acid
SMILESO=C(O)C=CCCCc1ccncc1
InChIInChI=1S/C11H13NO2/c13-11(14)5-3-1-2-4-10-6-8-12-9-7-10/h3,5-9H,1-2,4H2,(H,13,14)
InChIKeyMOFCAUVFRMCXJQ-UHFFFAOYSA-N
MW191.23 g/mol
LogP2.05
Rot. Bonds5

About 6-pyridin-4-ylhex-2-enoic acid

6-pyridin-4-ylhex-2-enoic acid (PubChem CID 54082671) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 6-pyridin-4-ylhex-2-enoic acid.

Molecular Properties

Compound Name6-pyridin-4-ylhex-2-enoic acid
PubChem CID54082671
Molecular FormulaC11H13NO2
Molecular Weight191.23 g/mol
Exact Mass191.09
IUPAC Name6-pyridin-4-ylhex-2-enoic acid
SMILESO=C(O)C=CCCCc1ccncc1
InChIInChI=1S/C11H13NO2/c13-11(14)5-3-1-2-4-10-6-8-12-9-7-10/h3,5-9H,1-2,4H2,(H,13,14)
InChIKeyMOFCAUVFRMCXJQ-UHFFFAOYSA-N
XLogP2.05
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.23
LogP ≤ 52.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 6-pyridin-4-ylhex-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-pyridin-4-ylhex-2-enoic acid?
The IUPAC name of 6-pyridin-4-ylhex-2-enoic acid (CID 54082671) is 6-pyridin-4-ylhex-2-enoic acid.
What is the SMILES notation for 6-pyridin-4-ylhex-2-enoic acid?
The canonical SMILES for 6-pyridin-4-ylhex-2-enoic acid is O=C(O)C=CCCCc1ccncc1.
What is the InChIKey of 6-pyridin-4-ylhex-2-enoic acid?
The InChIKey is MOFCAUVFRMCXJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c13-11(14)5-3-1-2-4-10-6-8-12-9-7-10/h3,5-9H,1-2,4H2,(H,13,14).
What are the key properties of 6-pyridin-4-ylhex-2-enoic acid?
6-pyridin-4-ylhex-2-enoic acid has a molecular weight of 191.23 g/mol, XLogP of 2.05, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-pyridin-4-ylhex-2-enoic acid is sourced from PubChem (CID 54082671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).