About acetic acid;3-pyridin-4-ylpropanoic acid
acetic acid;3-pyridin-4-ylpropanoic acid (PubChem CID 71346900) has the molecular formula C10H13NO4
and a molecular weight of 211.22 g/mol. Its IUPAC name is acetic acid;3-pyridin-4-ylpropanoic acid.
Molecular Properties
| Compound Name | acetic acid;3-pyridin-4-ylpropanoic acid |
| PubChem CID | 71346900 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | acetic acid;3-pyridin-4-ylpropanoic acid |
| SMILES | CC(=O)O.O=C(O)CCc1ccncc1 |
| InChI | InChI=1S/C8H9NO2.C2H4O2/c10-8(11)2-1-7-3-5-9-6-4-7;1-2(3)4/h3-6H,1-2H2,(H,10,11);1H3,(H,3,4) |
| InChIKey | ODSRSJGBCBQXOG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetic acid;3-pyridin-4-ylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;3-pyridin-4-ylpropanoic acid?
The IUPAC name of acetic acid;3-pyridin-4-ylpropanoic acid (CID 71346900) is acetic acid;3-pyridin-4-ylpropanoic acid.
What is the SMILES notation for acetic acid;3-pyridin-4-ylpropanoic acid?
The canonical SMILES for acetic acid;3-pyridin-4-ylpropanoic acid is CC(=O)O.O=C(O)CCc1ccncc1.
What is the InChIKey of acetic acid;3-pyridin-4-ylpropanoic acid?
The InChIKey is ODSRSJGBCBQXOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.C2H4O2/c10-8(11)2-1-7-3-5-9-6-4-7;1-2(3)4/h3-6H,1-2H2,(H,10,11);1H3,(H,3,4).
What are the key properties of acetic acid;3-pyridin-4-ylpropanoic acid?
acetic acid;3-pyridin-4-ylpropanoic acid has a molecular weight of 211.22 g/mol, XLogP of 1.19, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;3-pyridin-4-ylpropanoic acid is sourced from PubChem (CID 71346900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).