About 3-pyridin-4-ylpropanoyl iodide
3-pyridin-4-ylpropanoyl iodide (PubChem CID 171810746) has the molecular formula C8H8INO
and a molecular weight of 261.06 g/mol. Its IUPAC name is 3-pyridin-4-ylpropanoyl iodide.
Molecular Properties
| Compound Name | 3-pyridin-4-ylpropanoyl iodide |
| PubChem CID | 171810746 |
| Molecular Formula | C8H8INO |
| Molecular Weight | 261.06 g/mol |
| Exact Mass | 260.97 |
| IUPAC Name | 3-pyridin-4-ylpropanoyl iodide |
| SMILES | O=C(I)CCc1ccncc1 |
| InChI | InChI=1S/C8H8INO/c9-8(11)2-1-7-3-5-10-6-4-7/h3-6H,1-2H2 |
| InChIKey | XBPJOEZRWQPPBJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.06 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-pyridin-4-ylpropanoyl iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-4-ylpropanoyl iodide?
The IUPAC name of 3-pyridin-4-ylpropanoyl iodide (CID 171810746) is 3-pyridin-4-ylpropanoyl iodide.
What is the SMILES notation for 3-pyridin-4-ylpropanoyl iodide?
The canonical SMILES for 3-pyridin-4-ylpropanoyl iodide is O=C(I)CCc1ccncc1.
What is the InChIKey of 3-pyridin-4-ylpropanoyl iodide?
The InChIKey is XBPJOEZRWQPPBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8INO/c9-8(11)2-1-7-3-5-10-6-4-7/h3-6H,1-2H2.
What are the key properties of 3-pyridin-4-ylpropanoyl iodide?
3-pyridin-4-ylpropanoyl iodide has a molecular weight of 261.06 g/mol, XLogP of 1.98, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-4-ylpropanoyl iodide is sourced from PubChem (CID 171810746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).