C14H19N — CID 97114967
4-[(3Z,5Z)-nona-3,5-dien-5-yl]pyridine (PubChem CID 97114967) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 4-[(3Z,5Z)-nona-3,5-dien-5-yl]pyridine.
| Compound Name | 4-[(3Z,5Z)-nona-3,5-dien-5-yl]pyridine |
|---|---|
| PubChem CID | 97114967 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 4-[(3Z,5Z)-nona-3,5-dien-5-yl]pyridine |
| SMILES | CC/C=C\C(=C\CCC)c1ccncc1 |
| InChI | InChI=1S/C14H19N/c1-3-5-7-13(8-6-4-2)14-9-11-15-12-10-14/h5,7-12H,3-4,6H2,1-2H3/b7-5-,13-8- |
| InChIKey | HACPSRQILQUBMY-XKCBTEEFSA-N |
| XLogP | 4.23 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|