About butane;1-pyridin-4-ylethanone
butane;1-pyridin-4-ylethanone (PubChem CID 174655632) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is butane;1-pyridin-4-ylethanone.
Molecular Properties
| Compound Name | butane;1-pyridin-4-ylethanone |
| PubChem CID | 174655632 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | butane;1-pyridin-4-ylethanone |
| SMILES | CC(=O)c1ccncc1.CCCC |
| InChI | InChI=1S/C7H7NO.C4H10/c1-6(9)7-2-4-8-5-3-7;1-3-4-2/h2-5H,1H3;3-4H2,1-2H3 |
| InChIKey | GBQGAGJKPSIXCW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butane;1-pyridin-4-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;1-pyridin-4-ylethanone?
The IUPAC name of butane;1-pyridin-4-ylethanone (CID 174655632) is butane;1-pyridin-4-ylethanone.
What is the SMILES notation for butane;1-pyridin-4-ylethanone?
The canonical SMILES for butane;1-pyridin-4-ylethanone is CC(=O)c1ccncc1.CCCC.
What is the InChIKey of butane;1-pyridin-4-ylethanone?
The InChIKey is GBQGAGJKPSIXCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO.C4H10/c1-6(9)7-2-4-8-5-3-7;1-3-4-2/h2-5H,1H3;3-4H2,1-2H3.
What are the key properties of butane;1-pyridin-4-ylethanone?
butane;1-pyridin-4-ylethanone has a molecular weight of 179.26 g/mol, XLogP of 3.09, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane;1-pyridin-4-ylethanone is sourced from PubChem (CID 174655632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).