About pentan-2-one;pyridine-4-carboxylic acid
pentan-2-one;pyridine-4-carboxylic acid (PubChem CID 174864210) has the molecular formula C11H15NO3
and a molecular weight of 209.25 g/mol. Its IUPAC name is pentan-2-one;pyridine-4-carboxylic acid.
Molecular Properties
| Compound Name | pentan-2-one;pyridine-4-carboxylic acid |
| PubChem CID | 174864210 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | pentan-2-one;pyridine-4-carboxylic acid |
| SMILES | CCCC(C)=O.O=C(O)c1ccncc1 |
| InChI | InChI=1S/C6H5NO2.C5H10O/c8-6(9)5-1-3-7-4-2-5;1-3-4-5(2)6/h1-4H,(H,8,9);3-4H2,1-2H3 |
| InChIKey | PVBFXOLYCHVZDO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pentan-2-one;pyridine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-2-one;pyridine-4-carboxylic acid?
The IUPAC name of pentan-2-one;pyridine-4-carboxylic acid (CID 174864210) is pentan-2-one;pyridine-4-carboxylic acid.
What is the SMILES notation for pentan-2-one;pyridine-4-carboxylic acid?
The canonical SMILES for pentan-2-one;pyridine-4-carboxylic acid is CCCC(C)=O.O=C(O)c1ccncc1.
What is the InChIKey of pentan-2-one;pyridine-4-carboxylic acid?
The InChIKey is PVBFXOLYCHVZDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.C5H10O/c8-6(9)5-1-3-7-4-2-5;1-3-4-5(2)6/h1-4H,(H,8,9);3-4H2,1-2H3.
What are the key properties of pentan-2-one;pyridine-4-carboxylic acid?
pentan-2-one;pyridine-4-carboxylic acid has a molecular weight of 209.25 g/mol, XLogP of 2.16, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-2-one;pyridine-4-carboxylic acid is sourced from PubChem (CID 174864210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).