About 1-(4-bromophenyl)ethanone;butane
1-(4-bromophenyl)ethanone;butane (PubChem CID 69403420) has the molecular formula C12H17BrO
and a molecular weight of 257.17 g/mol. Its IUPAC name is 1-(4-bromophenyl)ethanone;butane.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)ethanone;butane |
| PubChem CID | 69403420 |
| Molecular Formula | C12H17BrO |
| Molecular Weight | 257.17 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 1-(4-bromophenyl)ethanone;butane |
| SMILES | CC(=O)c1ccc(Br)cc1.CCCC |
| InChI | InChI=1S/C8H7BrO.C4H10/c1-6(10)7-2-4-8(9)5-3-7;1-3-4-2/h2-5H,1H3;3-4H2,1-2H3 |
| InChIKey | XOICMMBRZORAPG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.17 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-bromophenyl)ethanone;butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)ethanone;butane?
The IUPAC name of 1-(4-bromophenyl)ethanone;butane (CID 69403420) is 1-(4-bromophenyl)ethanone;butane.
What is the SMILES notation for 1-(4-bromophenyl)ethanone;butane?
The canonical SMILES for 1-(4-bromophenyl)ethanone;butane is CC(=O)c1ccc(Br)cc1.CCCC.
What is the InChIKey of 1-(4-bromophenyl)ethanone;butane?
The InChIKey is XOICMMBRZORAPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrO.C4H10/c1-6(10)7-2-4-8(9)5-3-7;1-3-4-2/h2-5H,1H3;3-4H2,1-2H3.
What are the key properties of 1-(4-bromophenyl)ethanone;butane?
1-(4-bromophenyl)ethanone;butane has a molecular weight of 257.17 g/mol, XLogP of 4.46, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)ethanone;butane is sourced from PubChem (CID 69403420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).