About 1-(4-bromophenyl)ethanone;dimethyl carbonate
1-(4-bromophenyl)ethanone;dimethyl carbonate (PubChem CID 163740245) has the molecular formula C11H13BrO4
and a molecular weight of 289.13 g/mol. Its IUPAC name is 1-(4-bromophenyl)ethanone;dimethyl carbonate.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)ethanone;dimethyl carbonate |
| PubChem CID | 163740245 |
| Molecular Formula | C11H13BrO4 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 1-(4-bromophenyl)ethanone;dimethyl carbonate |
| SMILES | CC(=O)c1ccc(Br)cc1.COC(=O)OC |
| InChI | InChI=1S/C8H7BrO.C3H6O3/c1-6(10)7-2-4-8(9)5-3-7;1-5-3(4)6-2/h2-5H,1H3;1-2H3 |
| InChIKey | LHCPRLBTFNEDKY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-bromophenyl)ethanone;dimethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)ethanone;dimethyl carbonate?
The IUPAC name of 1-(4-bromophenyl)ethanone;dimethyl carbonate (CID 163740245) is 1-(4-bromophenyl)ethanone;dimethyl carbonate.
What is the SMILES notation for 1-(4-bromophenyl)ethanone;dimethyl carbonate?
The canonical SMILES for 1-(4-bromophenyl)ethanone;dimethyl carbonate is CC(=O)c1ccc(Br)cc1.COC(=O)OC.
What is the InChIKey of 1-(4-bromophenyl)ethanone;dimethyl carbonate?
The InChIKey is LHCPRLBTFNEDKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrO.C3H6O3/c1-6(10)7-2-4-8(9)5-3-7;1-5-3(4)6-2/h2-5H,1H3;1-2H3.
What are the key properties of 1-(4-bromophenyl)ethanone;dimethyl carbonate?
1-(4-bromophenyl)ethanone;dimethyl carbonate has a molecular weight of 289.13 g/mol, XLogP of 3.05, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)ethanone;dimethyl carbonate is sourced from PubChem (CID 163740245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).