C20H14Br2O6 — CID 102211494
dimethyl (Z)-2,3-bis(4-bromobenzoyl)but-2-enedioate (PubChem CID 102211494) has the molecular formula C20H14Br2O6 and a molecular weight of 510.13 g/mol. Its IUPAC name is dimethyl (Z)-2,3-bis(4-bromobenzoyl)but-2-enedioate.
| Compound Name | dimethyl (Z)-2,3-bis(4-bromobenzoyl)but-2-enedioate |
|---|---|
| PubChem CID | 102211494 |
| Molecular Formula | C20H14Br2O6 |
| Molecular Weight | 510.13 g/mol |
| Exact Mass | 507.92 |
| IUPAC Name | dimethyl (Z)-2,3-bis(4-bromobenzoyl)but-2-enedioate |
| SMILES | COC(=O)/C(C(=O)c1ccc(Br)cc1)=C(\C(=O)OC)C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H14Br2O6/c1-27-19(25)15(17(23)11-3-7-13(21)8-4-11)16(20(26)28-2)18(24)12-5-9-14(22)10-6-12/h3-10H,1-2H3/b16-15- |
| InChIKey | HJIIPHFYIGXDFW-NXVVXOECSA-N |
| XLogP | 3.92 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.13 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|