C17H13BrO3 — CID 7308092
1-(4-bromophenyl)-2-[hydroxy(phenyl)methylidene]butane-1,3-dione (PubChem CID 7308092) has the molecular formula C17H13BrO3 and a molecular weight of 345.19 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-[hydroxy(phenyl)methylidene]butane-1,3-dione.
| Compound Name | 1-(4-bromophenyl)-2-[hydroxy(phenyl)methylidene]butane-1,3-dione |
|---|---|
| PubChem CID | 7308092 |
| Molecular Formula | C17H13BrO3 |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 1-(4-bromophenyl)-2-[hydroxy(phenyl)methylidene]butane-1,3-dione |
| SMILES | CC(=O)C(C(=O)c1ccc(Br)cc1)=C(O)c1ccccc1 |
| InChI | InChI=1S/C17H13BrO3/c1-11(19)15(16(20)12-5-3-2-4-6-12)17(21)13-7-9-14(18)10-8-13/h2-10,20H,1H3 |
| InChIKey | TXLSWKDRMWCYOI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|