About (4-bromophenyl)-phenylmethanone;but-2-yne;methanethiol
(4-bromophenyl)-phenylmethanone;but-2-yne;methanethiol (PubChem CID 142477288) has the molecular formula C18H19BrOS
and a molecular weight of 363.32 g/mol. Its IUPAC name is (4-bromophenyl)-phenylmethanone;but-2-yne;methanethiol.
Molecular Properties
| Compound Name | (4-bromophenyl)-phenylmethanone;but-2-yne;methanethiol |
| PubChem CID | 142477288 |
| Molecular Formula | C18H19BrOS |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | (4-bromophenyl)-phenylmethanone;but-2-yne;methanethiol |
| SMILES | CC#CC.CS.O=C(c1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H9BrO.C4H6.CH4S/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10;1-3-4-2;1-2/h1-9H;1-2H3;2H,1H3 |
| InChIKey | NHEPRIBESGKFCW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-bromophenyl)-phenylmethanone;but-2-yne;methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl)-phenylmethanone;but-2-yne;methanethiol?
The IUPAC name of (4-bromophenyl)-phenylmethanone;but-2-yne;methanethiol (CID 142477288) is (4-bromophenyl)-phenylmethanone;but-2-yne;methanethiol.
What is the SMILES notation for (4-bromophenyl)-phenylmethanone;but-2-yne;methanethiol?
The canonical SMILES for (4-bromophenyl)-phenylmethanone;but-2-yne;methanethiol is CC#CC.CS.O=C(c1ccccc1)c1ccc(Br)cc1.
What is the InChIKey of (4-bromophenyl)-phenylmethanone;but-2-yne;methanethiol?
The InChIKey is NHEPRIBESGKFCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrO.C4H6.CH4S/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10;1-3-4-2;1-2/h1-9H;1-2H3;2H,1H3.
What are the key properties of (4-bromophenyl)-phenylmethanone;but-2-yne;methanethiol?
(4-bromophenyl)-phenylmethanone;but-2-yne;methanethiol has a molecular weight of 363.32 g/mol, XLogP of 5.26, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl)-phenylmethanone;but-2-yne;methanethiol is sourced from PubChem (CID 142477288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).