C12H22S — CID 129267420
(3Z,5E)-5-propylsulfanylnona-3,5-diene (PubChem CID 129267420) has the molecular formula C12H22S and a molecular weight of 198.37 g/mol. Its IUPAC name is (3Z,5E)-5-propylsulfanylnona-3,5-diene.
| Compound Name | (3Z,5E)-5-propylsulfanylnona-3,5-diene |
|---|---|
| PubChem CID | 129267420 |
| Molecular Formula | C12H22S |
| Molecular Weight | 198.37 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | (3Z,5E)-5-propylsulfanylnona-3,5-diene |
| SMILES | CC/C=C\C(=C/CCC)SCCC |
| InChI | InChI=1S/C12H22S/c1-4-7-9-12(10-8-5-2)13-11-6-3/h7,9-10H,4-6,8,11H2,1-3H3/b9-7-,12-10+ |
| InChIKey | QMQMYHWOLCVQLM-LBTWLYDDSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.37 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|