About Nona-3,5-dien-5-amine
Nona-3,5-dien-5-amine (PubChem CID 173041910) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is nona-3,5-dien-5-amine.
Molecular Properties
| Compound Name | Nona-3,5-dien-5-amine |
| PubChem CID | 173041910 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | nona-3,5-dien-5-amine |
| SMILES | CCCC=C(C=CCC)N |
| InChI | InChI=1S/C9H17N/c1-3-5-7-9(10)8-6-4-2/h5,7-8H,3-4,6,10H2,1-2H3 |
| InChIKey | GJKZKXGMKXHZCM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | 123 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze Nona-3,5-dien-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Nona-3,5-dien-5-amine?
The IUPAC name of Nona-3,5-dien-5-amine (CID 173041910) is nona-3,5-dien-5-amine.
What is the SMILES notation for Nona-3,5-dien-5-amine?
The canonical SMILES for Nona-3,5-dien-5-amine is CCCC=C(C=CCC)N.
What is the InChIKey of Nona-3,5-dien-5-amine?
The InChIKey is GJKZKXGMKXHZCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N/c1-3-5-7-9(10)8-6-4-2/h5,7-8H,3-4,6,10H2,1-2H3.
What are the key properties of Nona-3,5-dien-5-amine?
Nona-3,5-dien-5-amine has a molecular weight of 139.24 g/mol, XLogP of 2.80, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Nona-3,5-dien-5-amine is sourced from PubChem (CID 173041910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).