C8H15NO — CID 142871963
(2Z,4Z)-4-aminoocta-2,4-dien-2-ol (PubChem CID 142871963) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is (2Z,4Z)-4-aminoocta-2,4-dien-2-ol.
| Compound Name | (2Z,4Z)-4-aminoocta-2,4-dien-2-ol |
|---|---|
| PubChem CID | 142871963 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | (2Z,4Z)-4-aminoocta-2,4-dien-2-ol |
| SMILES | CCC/C=C(N)/C=C(/C)O |
| InChI | InChI=1S/C8H15NO/c1-3-4-5-8(9)6-7(2)10/h5-6,10H,3-4,9H2,1-2H3/b7-6-,8-5- |
| InChIKey | SFMCWHFHCZKUNZ-HSHIGALWSA-N |
| XLogP | 2.09 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|