About N'-[(Z)-hex-2-en-2-yl]-2,2-dimethylpropanimidamide
N'-[(Z)-hex-2-en-2-yl]-2,2-dimethylpropanimidamide (PubChem CID 126735392) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is N'-[(Z)-hex-2-en-2-yl]-2,2-dimethylpropanimidamide.
Molecular Properties
| Compound Name | N'-[(Z)-hex-2-en-2-yl]-2,2-dimethylpropanimidamide |
| PubChem CID | 126735392 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | N'-[(Z)-hex-2-en-2-yl]-2,2-dimethylpropanimidamide |
| SMILES | CCC/C=C(C)\N=C(/N)C(C)(C)C |
| InChI | InChI=1S/C11H22N2/c1-6-7-8-9(2)13-10(12)11(3,4)5/h8H,6-7H2,1-5H3,(H2,12,13)/b9-8- |
| InChIKey | LCPOSNIDARQMMG-HJWRWDBZSA-N |
| XLogP | 3.09 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[(Z)-hex-2-en-2-yl]-2,2-dimethylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(Z)-hex-2-en-2-yl]-2,2-dimethylpropanimidamide?
The IUPAC name of N'-[(Z)-hex-2-en-2-yl]-2,2-dimethylpropanimidamide (CID 126735392) is N'-[(Z)-hex-2-en-2-yl]-2,2-dimethylpropanimidamide.
What is the SMILES notation for N'-[(Z)-hex-2-en-2-yl]-2,2-dimethylpropanimidamide?
The canonical SMILES for N'-[(Z)-hex-2-en-2-yl]-2,2-dimethylpropanimidamide is CCC/C=C(C)\N=C(/N)C(C)(C)C.
What is the InChIKey of N'-[(Z)-hex-2-en-2-yl]-2,2-dimethylpropanimidamide?
The InChIKey is LCPOSNIDARQMMG-HJWRWDBZSA-N. The full InChI is InChI=1S/C11H22N2/c1-6-7-8-9(2)13-10(12)11(3,4)5/h8H,6-7H2,1-5H3,(H2,12,13)/b9-8-.
What are the key properties of N'-[(Z)-hex-2-en-2-yl]-2,2-dimethylpropanimidamide?
N'-[(Z)-hex-2-en-2-yl]-2,2-dimethylpropanimidamide has a molecular weight of 182.31 g/mol, XLogP of 3.09, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(Z)-hex-2-en-2-yl]-2,2-dimethylpropanimidamide is sourced from PubChem (CID 126735392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).