C10H18S2 — CID 139386659
(1E,3E)-1-methylsulfanyl-1-propylsulfanylhexa-1,3-diene (PubChem CID 139386659) has the molecular formula C10H18S2 and a molecular weight of 202.39 g/mol. Its IUPAC name is (1E,3E)-1-methylsulfanyl-1-propylsulfanylhexa-1,3-diene.
| Compound Name | (1E,3E)-1-methylsulfanyl-1-propylsulfanylhexa-1,3-diene |
|---|---|
| PubChem CID | 139386659 |
| Molecular Formula | C10H18S2 |
| Molecular Weight | 202.39 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | (1E,3E)-1-methylsulfanyl-1-propylsulfanylhexa-1,3-diene |
| SMILES | CC/C=C/C=C(\SC)SCCC |
| InChI | InChI=1S/C10H18S2/c1-4-6-7-8-10(11-3)12-9-5-2/h6-8H,4-5,9H2,1-3H3/b7-6+,10-8+ |
| InChIKey | NTNZTXZJEFLIPV-LQPGMRSMSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|