C8H16NO+ — CID 142322439
[(2Z,4Z)-hepta-2,4-dien-2-yl]-methoxyazanium (PubChem CID 142322439) has the molecular formula C8H16NO+ and a molecular weight of 142.22 g/mol. Its IUPAC name is [(2Z,4Z)-hepta-2,4-dien-2-yl]-methoxyazanium.
| Compound Name | [(2Z,4Z)-hepta-2,4-dien-2-yl]-methoxyazanium |
|---|---|
| PubChem CID | 142322439 |
| Molecular Formula | C8H16NO+ |
| Molecular Weight | 142.22 g/mol |
| Exact Mass | 142.12 |
| IUPAC Name | [(2Z,4Z)-hepta-2,4-dien-2-yl]-methoxyazanium |
| SMILES | CC/C=C\C=C(\C)[NH2+]OC |
| InChI | InChI=1S/C8H15NO/c1-4-5-6-7-8(2)9-10-3/h5-7,9H,4H2,1-3H3/p+1/b6-5-,8-7- |
| InChIKey | STEKDHIOHYSVLL-ISTTXYCBSA-O |
| XLogP | 0.98 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|