C8H14O — CID 173250100
(2E,4E)-2-methylhepta-2,4-dien-1-ol (PubChem CID 173250100) has the molecular formula C8H14O and a molecular weight of 126.20 g/mol. Its IUPAC name is (2E,4E)-2-methylhepta-2,4-dien-1-ol.
| Compound Name | (2E,4E)-2-methylhepta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 173250100 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (2E,4E)-2-methylhepta-2,4-dien-1-ol |
| SMILES | CC/C=C/C=C(\C)CO |
| InChI | InChI=1S/C8H14O/c1-3-4-5-6-8(2)7-9/h4-6,9H,3,7H2,1-2H3/b5-4+,8-6+ |
| InChIKey | XKECKWRSDXQZGM-DVBIZMGNSA-N |
| XLogP | 1.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|