C13H24O — CID 16737921
(2E,4E)-2-methyldodeca-2,4-dien-1-ol (PubChem CID 16737921) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is (2E,4E)-2-methyldodeca-2,4-dien-1-ol.
| Compound Name | (2E,4E)-2-methyldodeca-2,4-dien-1-ol |
|---|---|
| PubChem CID | 16737921 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | (2E,4E)-2-methyldodeca-2,4-dien-1-ol |
| SMILES | CCCCCCC/C=C/C=C(\C)CO |
| InChI | InChI=1S/C13H24O/c1-3-4-5-6-7-8-9-10-11-13(2)12-14/h9-11,14H,3-8,12H2,1-2H3/b10-9+,13-11+ |
| InChIKey | ARTJJQZPAKPOFQ-SNMPHBPQSA-N |
| XLogP | 3.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|