C16H29NO — CID 169003282
(2E,4E)-2-methylpentadeca-2,4-dienamide (PubChem CID 169003282) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is (2E,4E)-2-methylpentadeca-2,4-dienamide.
| Compound Name | (2E,4E)-2-methylpentadeca-2,4-dienamide |
|---|---|
| PubChem CID | 169003282 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | (2E,4E)-2-methylpentadeca-2,4-dienamide |
| SMILES | CCCCCCCCCC/C=C/C=C(\C)C(N)=O |
| InChI | InChI=1S/C16H29NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(2)16(17)18/h12-14H,3-11H2,1-2H3,(H2,17,18)/b13-12+,15-14+ |
| InChIKey | KFSONFAJZAIEMM-SQIWNDBBSA-N |
| XLogP | 4.51 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|