C24H37NO — CID 169003273
(2E,4E,6E,8E,10E,12E)-2-methyltricosa-2,4,6,8,10,12-hexaenamide (PubChem CID 169003273) has the molecular formula C24H37NO and a molecular weight of 355.57 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E,12E)-2-methyltricosa-2,4,6,8,10,12-hexaenamide.
| Compound Name | (2E,4E,6E,8E,10E,12E)-2-methyltricosa-2,4,6,8,10,12-hexaenamide |
|---|---|
| PubChem CID | 169003273 |
| Molecular Formula | C24H37NO |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 355.29 |
| IUPAC Name | (2E,4E,6E,8E,10E,12E)-2-methyltricosa-2,4,6,8,10,12-hexaenamide |
| SMILES | CCCCCCCCCC/C=C/C=C/C=C/C=C/C=C/C=C(\C)C(N)=O |
| InChI | InChI=1S/C24H37NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(2)24(25)26/h12-22H,3-11H2,1-2H3,(H2,25,26)/b13-12+,15-14+,17-16+,19-18+,21-20+,23-22+ |
| InChIKey | SVLFIURSNFBRIO-DNKOKRCQSA-N |
| XLogP | 6.73 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|