C20H33NO — CID 165388962
(1E,3E,5E,7E,9E)-1-aminoicosa-1,3,5,7,9-pentaen-1-ol (PubChem CID 165388962) has the molecular formula C20H33NO and a molecular weight of 303.49 g/mol. Its IUPAC name is (1E,3E,5E,7E,9E)-1-aminoicosa-1,3,5,7,9-pentaen-1-ol.
| Compound Name | (1E,3E,5E,7E,9E)-1-aminoicosa-1,3,5,7,9-pentaen-1-ol |
|---|---|
| PubChem CID | 165388962 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | (1E,3E,5E,7E,9E)-1-aminoicosa-1,3,5,7,9-pentaen-1-ol |
| SMILES | CCCCCCCCCC/C=C/C=C/C=C/C=C/C=C(\N)O |
| InChI | InChI=1S/C20H33NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h11-19,22H,2-10,21H2,1H3/b12-11+,14-13+,16-15+,18-17+,20-19+ |
| InChIKey | AYIKIKCOCKMKNQ-KJTFIQBESA-N |
| XLogP | 6.10 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|