About ethane;(2E,4Z)-hepta-2,4-dien-2-ol
ethane;(2E,4Z)-hepta-2,4-dien-2-ol (PubChem CID 142115176) has the molecular formula C9H18O
and a molecular weight of 142.24 g/mol. Its IUPAC name is ethane;(2E,4Z)-hepta-2,4-dien-2-ol.
Molecular Properties
| Compound Name | ethane;(2E,4Z)-hepta-2,4-dien-2-ol |
| PubChem CID | 142115176 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | ethane;(2E,4Z)-hepta-2,4-dien-2-ol |
| SMILES | CC.CC/C=C\C=C(/C)O |
| InChI | InChI=1S/C7H12O.C2H6/c1-3-4-5-6-7(2)8;1-2/h4-6,8H,3H2,1-2H3;1-2H3/b5-4-,7-6+; |
| InChIKey | PFWMBFTWKJPAKP-YLKXMWBMSA-N |
| XLogP | 3.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(2E,4Z)-hepta-2,4-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2E,4Z)-hepta-2,4-dien-2-ol?
The IUPAC name of ethane;(2E,4Z)-hepta-2,4-dien-2-ol (CID 142115176) is ethane;(2E,4Z)-hepta-2,4-dien-2-ol.
What is the SMILES notation for ethane;(2E,4Z)-hepta-2,4-dien-2-ol?
The canonical SMILES for ethane;(2E,4Z)-hepta-2,4-dien-2-ol is CC.CC/C=C\C=C(/C)O.
What is the InChIKey of ethane;(2E,4Z)-hepta-2,4-dien-2-ol?
The InChIKey is PFWMBFTWKJPAKP-YLKXMWBMSA-N. The full InChI is InChI=1S/C7H12O.C2H6/c1-3-4-5-6-7(2)8;1-2/h4-6,8H,3H2,1-2H3;1-2H3/b5-4-,7-6+;.
What are the key properties of ethane;(2E,4Z)-hepta-2,4-dien-2-ol?
ethane;(2E,4Z)-hepta-2,4-dien-2-ol has a molecular weight of 142.24 g/mol, XLogP of 3.44, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2E,4Z)-hepta-2,4-dien-2-ol is sourced from PubChem (CID 142115176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).