C9H18O — CID 142115176
ethane;(2E,4Z)-hepta-2,4-dien-2-ol (PubChem CID 142115176) has the molecular formula C9H18O and a molecular weight of 142.24 g/mol. Its IUPAC name is ethane;(2E,4Z)-hepta-2,4-dien-2-ol.
| Compound Name | ethane;(2E,4Z)-hepta-2,4-dien-2-ol |
|---|---|
| PubChem CID | 142115176 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | ethane;(2E,4Z)-hepta-2,4-dien-2-ol |
| SMILES | CC.CC/C=C\C=C(/C)O |
| InChI | InChI=1S/C7H12O.C2H6/c1-3-4-5-6-7(2)8;1-2/h4-6,8H,3H2,1-2H3;1-2H3/b5-4-,7-6+; |
| InChIKey | PFWMBFTWKJPAKP-YLKXMWBMSA-N |
| XLogP | 3.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|