C8H14S — CID 145391343
(2E,4Z)-2-methylhepta-2,4-diene-1-thiol (PubChem CID 145391343) has the molecular formula C8H14S and a molecular weight of 142.27 g/mol. Its IUPAC name is (2E,4Z)-2-methylhepta-2,4-diene-1-thiol.
| Compound Name | (2E,4Z)-2-methylhepta-2,4-diene-1-thiol |
|---|---|
| PubChem CID | 145391343 |
| Molecular Formula | C8H14S |
| Molecular Weight | 142.27 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | (2E,4Z)-2-methylhepta-2,4-diene-1-thiol |
| SMILES | CC/C=C\C=C(/C)CS |
| InChI | InChI=1S/C8H14S/c1-3-4-5-6-8(2)7-9/h4-6,9H,3,7H2,1-2H3/b5-4-,8-6+ |
| InChIKey | JWBNYIAKCZRJEE-GSGSLZOQSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|