C8H15NO — CID 163982381
(2E,4Z)-1-amino-2-methylhepta-2,4-dien-1-ol (PubChem CID 163982381) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is (2E,4Z)-1-amino-2-methylhepta-2,4-dien-1-ol.
| Compound Name | (2E,4Z)-1-amino-2-methylhepta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 163982381 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | (2E,4Z)-1-amino-2-methylhepta-2,4-dien-1-ol |
| SMILES | CC/C=C\C=C(/C)C(N)O |
| InChI | InChI=1S/C8H15NO/c1-3-4-5-6-7(2)8(9)10/h4-6,8,10H,3,9H2,1-2H3/b5-4-,7-6+ |
| InChIKey | SZOBGFOLYGUHSX-SCFJQAPRSA-N |
| XLogP | 1.18 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|