C13H17ClO — CID 143036281
(2E,4Z)-2-[(1E,3Z)-5-chlorohexa-1,3,5-trienoxy]hepta-2,4-diene (PubChem CID 143036281) has the molecular formula C13H17ClO and a molecular weight of 224.73 g/mol. Its IUPAC name is (2E,4Z)-2-[(1E,3Z)-5-chlorohexa-1,3,5-trienoxy]hepta-2,4-diene.
| Compound Name | (2E,4Z)-2-[(1E,3Z)-5-chlorohexa-1,3,5-trienoxy]hepta-2,4-diene |
|---|---|
| PubChem CID | 143036281 |
| Molecular Formula | C13H17ClO |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (2E,4Z)-2-[(1E,3Z)-5-chlorohexa-1,3,5-trienoxy]hepta-2,4-diene |
| SMILES | C=C(Cl)/C=C\C=C\O/C(C)=C/C=C\CC |
| InChI | InChI=1S/C13H17ClO/c1-4-5-6-10-13(3)15-11-8-7-9-12(2)14/h5-11H,2,4H2,1,3H3/b6-5-,9-7-,11-8+,13-10+ |
| InChIKey | GBLZYKHNURVHMT-PWWWCYRESA-N |
| XLogP | 4.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|