C9H18 — CID 142130371
ethane;(3Z)-2-methylhexa-1,3-diene (PubChem CID 142130371) has the molecular formula C9H18 and a molecular weight of 126.24 g/mol. Its IUPAC name is ethane;(3Z)-2-methylhexa-1,3-diene.
| Compound Name | ethane;(3Z)-2-methylhexa-1,3-diene |
|---|---|
| PubChem CID | 142130371 |
| Molecular Formula | C9H18 |
| Molecular Weight | 126.24 g/mol |
| Exact Mass | 126.14 |
| IUPAC Name | ethane;(3Z)-2-methylhexa-1,3-diene |
| SMILES | C=C(C)/C=C\CC.CC |
| InChI | InChI=1S/C7H12.C2H6/c1-4-5-6-7(2)3;1-2/h5-6H,2,4H2,1,3H3;1-2H3/b6-5-; |
| InChIKey | TUIBHYNPJWPCKG-YSMBQZINSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.24 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|