C11H25N — CID 144512893
ethane;(3Z)-hexa-1,3-dien-2-amine;propane (PubChem CID 144512893) has the molecular formula C11H25N and a molecular weight of 171.33 g/mol. Its IUPAC name is ethane;(3Z)-hexa-1,3-dien-2-amine;propane.
| Compound Name | ethane;(3Z)-hexa-1,3-dien-2-amine;propane |
|---|---|
| PubChem CID | 144512893 |
| Molecular Formula | C11H25N |
| Molecular Weight | 171.33 g/mol |
| Exact Mass | 171.20 |
| IUPAC Name | ethane;(3Z)-hexa-1,3-dien-2-amine;propane |
| SMILES | C=C(N)/C=C\CC.CC.CCC |
| InChI | InChI=1S/C6H11N.C3H8.C2H6/c1-3-4-5-6(2)7;1-3-2;1-2/h4-5H,2-3,7H2,1H3;3H2,1-2H3;1-2H3/b5-4-;; |
| InChIKey | RBNCIRZMOJDSKS-WNCVTPEDSA-N |
| XLogP | 3.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|