C10H21N — CID 145261279
ethane;(4Z)-2-methylhepta-2,4-dien-3-amine (PubChem CID 145261279) has the molecular formula C10H21N and a molecular weight of 155.28 g/mol. Its IUPAC name is ethane;(4Z)-2-methylhepta-2,4-dien-3-amine.
| Compound Name | ethane;(4Z)-2-methylhepta-2,4-dien-3-amine |
|---|---|
| PubChem CID | 145261279 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | ethane;(4Z)-2-methylhepta-2,4-dien-3-amine |
| SMILES | CC.CC/C=C\C(N)=C(C)C |
| InChI | InChI=1S/C8H15N.C2H6/c1-4-5-6-8(9)7(2)3;1-2/h5-6H,4,9H2,1-3H3;1-2H3/b6-5-; |
| InChIKey | VNCPDDDGUICNIG-YSMBQZINSA-N |
| XLogP | 3.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|