C13H24N2 — CID 167113133
(3E,5Z,7Z)-6-N,6-N,3-trimethyldeca-3,5,7-triene-5,6-diamine (PubChem CID 167113133) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is (3E,5Z,7Z)-6-N,6-N,3-trimethyldeca-3,5,7-triene-5,6-diamine.
| Compound Name | (3E,5Z,7Z)-6-N,6-N,3-trimethyldeca-3,5,7-triene-5,6-diamine |
|---|---|
| PubChem CID | 167113133 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | (3E,5Z,7Z)-6-N,6-N,3-trimethyldeca-3,5,7-triene-5,6-diamine |
| SMILES | CC/C=C\C(=C(N)/C=C(\C)CC)N(C)C |
| InChI | InChI=1S/C13H24N2/c1-6-8-9-13(15(4)5)12(14)10-11(3)7-2/h8-10H,6-7,14H2,1-5H3/b9-8-,11-10+,13-12- |
| InChIKey | UABALWGONCTIOK-DIZFDERBSA-N |
| XLogP | 3.04 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|