C12H20 — CID 142428664
(4E,5Z)-4-ethylidene-2,3-dimethylocta-2,5-diene (PubChem CID 142428664) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is (4E,5Z)-4-ethylidene-2,3-dimethylocta-2,5-diene.
| Compound Name | (4E,5Z)-4-ethylidene-2,3-dimethylocta-2,5-diene |
|---|---|
| PubChem CID | 142428664 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | (4E,5Z)-4-ethylidene-2,3-dimethylocta-2,5-diene |
| SMILES | C/C=C(\C=C/CC)C(C)=C(C)C |
| InChI | InChI=1S/C12H20/c1-6-8-9-12(7-2)11(5)10(3)4/h7-9H,6H2,1-5H3/b9-8-,12-7+ |
| InChIKey | CFJHXXAIWRYHBT-ZHCAKQDLSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|