C7H11F — CID 143797404
(2E)-3-fluorohepta-2,4-diene (PubChem CID 143797404) has the molecular formula C7H11F and a molecular weight of 114.16 g/mol. Its IUPAC name is (2E)-3-fluorohepta-2,4-diene.
| Compound Name | (2E)-3-fluorohepta-2,4-diene |
|---|---|
| PubChem CID | 143797404 |
| Molecular Formula | C7H11F |
| Molecular Weight | 114.16 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | (2E)-3-fluorohepta-2,4-diene |
| SMILES | C/C=C(/F)C=CCC |
| InChI | InChI=1S/C7H11F/c1-3-5-6-7(8)4-2/h4-6H,3H2,1-2H3/b6-5?,7-4+ |
| InChIKey | LVOQQSCQKHBICP-YYOJXJPWSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.16 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|