C17H28F2 — CID 143078029
(2E,4Z)-3-fluoronona-2,4-diene;(2E,4Z)-2-fluoroocta-2,4-diene (PubChem CID 143078029) has the molecular formula C17H28F2 and a molecular weight of 270.41 g/mol. Its IUPAC name is (2E,4Z)-3-fluoronona-2,4-diene;(2E,4Z)-2-fluoroocta-2,4-diene.
| Compound Name | (2E,4Z)-3-fluoronona-2,4-diene;(2E,4Z)-2-fluoroocta-2,4-diene |
|---|---|
| PubChem CID | 143078029 |
| Molecular Formula | C17H28F2 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | (2E,4Z)-3-fluoronona-2,4-diene;(2E,4Z)-2-fluoroocta-2,4-diene |
| SMILES | C/C=C(F)\C=C/CCCC.CCC/C=C\C=C(/C)F |
| InChI | InChI=1S/C9H15F.C8H13F/c1-3-5-6-7-8-9(10)4-2;1-3-4-5-6-7-8(2)9/h4,7-8H,3,5-6H2,1-2H3;5-7H,3-4H2,1-2H3/b8-7-,9-4+;6-5-,8-7+ |
| InChIKey | IJBQWJLIVVPBAH-SSQSTLAYSA-N |
| XLogP | 6.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|