C8H12Cl2Pd — CID 87090262
1,1-dichloroocta-1,3-diene;palladium (PubChem CID 87090262) has the molecular formula C8H12Cl2Pd and a molecular weight of 285.51 g/mol. Its IUPAC name is 1,1-dichloroocta-1,3-diene;palladium.
| Compound Name | 1,1-dichloroocta-1,3-diene;palladium |
|---|---|
| PubChem CID | 87090262 |
| Molecular Formula | C8H12Cl2Pd |
| Molecular Weight | 285.51 g/mol |
| Exact Mass | 283.94 |
| IUPAC Name | 1,1-dichloroocta-1,3-diene;palladium |
| SMILES | CCCCC=CC=C(Cl)Cl.[Pd] |
| InChI | InChI=1S/C8H12Cl2.Pd/c1-2-3-4-5-6-7-8(9)10;/h5-7H,2-4H2,1H3; |
| InChIKey | JMNRCEBOUJQMHN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|