C12H22O — CID 87161212
(5Z)-dodeca-5,7-dien-5-ol (PubChem CID 87161212) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is (5Z)-dodeca-5,7-dien-5-ol.
| Compound Name | (5Z)-dodeca-5,7-dien-5-ol |
|---|---|
| PubChem CID | 87161212 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | (5Z)-dodeca-5,7-dien-5-ol |
| SMILES | CCCCC=C/C=C(\O)CCCC |
| InChI | InChI=1S/C12H22O/c1-3-5-7-8-9-11-12(13)10-6-4-2/h8-9,11,13H,3-7,10H2,1-2H3/b9-8?,12-11- |
| InChIKey | YGELKALLBUKMNI-ZMLDDQSSSA-N |
| XLogP | 4.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|