C18H32 — CID 57162564
(5E,7Z)-13-methylideneheptadeca-5,7-diene (PubChem CID 57162564) has the molecular formula C18H32 and a molecular weight of 248.45 g/mol. Its IUPAC name is (5E,7Z)-13-methylideneheptadeca-5,7-diene.
| Compound Name | (5E,7Z)-13-methylideneheptadeca-5,7-diene |
|---|---|
| PubChem CID | 57162564 |
| Molecular Formula | C18H32 |
| Molecular Weight | 248.45 g/mol |
| Exact Mass | 248.25 |
| IUPAC Name | (5E,7Z)-13-methylideneheptadeca-5,7-diene |
| SMILES | C=C(CCCC)CCCC/C=C\C=C\CCCC |
| InChI | InChI=1S/C18H32/c1-4-6-8-9-10-11-12-13-14-15-17-18(3)16-7-5-2/h9-12H,3-8,13-17H2,1-2H3/b10-9+,12-11- |
| InChIKey | CYTHAWLVBYZVPG-PVHUKWJHSA-N |
| XLogP | 6.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.45 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|