C22H36O4 — CID 174415565
2-methylprop-2-enoic acid;octadeca-9,11,13-trienoic acid (PubChem CID 174415565) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;octadeca-9,11,13-trienoic acid.
| Compound Name | 2-methylprop-2-enoic acid;octadeca-9,11,13-trienoic acid |
|---|---|
| PubChem CID | 174415565 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | 2-methylprop-2-enoic acid;octadeca-9,11,13-trienoic acid |
| SMILES | C=C(C)C(=O)O.CCCCC=CC=CC=CCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H30O2.C4H6O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3(2)4(5)6/h5-10H,2-4,11-17H2,1H3,(H,19,20);1H2,2H3,(H,5,6) |
| InChIKey | DBJGMQWUPCDPRR-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|